C17H16N3O2+ — CID 157164878
7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium (PubChem CID 157164878) has the molecular formula C17H16N3O2+ and a molecular weight of 294.33 g/mol. Its IUPAC name is 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium.
| Compound Name | 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium |
|---|---|
| PubChem CID | 157164878 |
| Molecular Formula | C17H16N3O2+ |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium |
| SMILES | CC[N+]1=C2C=CC=CC2N2C1=CC=C1C=C([N+](=O)[O-])C=CC12 |
| InChI | InChI=1S/C17H16N3O2/c1-2-18-15-5-3-4-6-16(15)19-14-9-8-13(20(21)22)11-12(14)7-10-17(18)19/h3-11,14,16H,2H2,1H3/q+1 |
| InChIKey | IOASLEKLIRXWOE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|