About 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium
7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium (PubChem CID 157164878) has the molecular formula C17H16N3O2+
and a molecular weight of 294.33 g/mol. Its IUPAC name is 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium.
Molecular Properties
| Compound Name | 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium |
| PubChem CID | 157164878 |
| Molecular Formula | C17H16N3O2+ |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium |
| SMILES | CC[N+]1=C2C=CC=CC2N2C1=CC=C1C=C([N+](=O)[O-])C=CC12 |
| InChI | InChI=1S/C17H16N3O2/c1-2-18-15-5-3-4-6-16(15)19-14-9-8-13(20(21)22)11-12(14)7-10-17(18)19/h3-11,14,16H,2H2,1H3/q+1 |
| InChIKey | IOASLEKLIRXWOE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium?
The IUPAC name of 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium (CID 157164878) is 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium.
What is the SMILES notation for 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium?
The canonical SMILES for 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium is CC[N+]1=C2C=CC=CC2N2C1=CC=C1C=C([N+](=O)[O-])C=CC12.
What is the InChIKey of 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium?
The InChIKey is IOASLEKLIRXWOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N3O2/c1-2-18-15-5-3-4-6-16(15)19-14-9-8-13(20(21)22)11-12(14)7-10-17(18)19/h3-11,14,16H,2H2,1H3/q+1.
What are the key properties of 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium?
7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium has a molecular weight of 294.33 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-3-nitro-11a,12a-dihydrobenzimidazolo[1,2-a]quinolin-7-ium is sourced from PubChem (CID 157164878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).