About 13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene
13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene (PubChem CID 15716524) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene.
Molecular Properties
| Compound Name | 13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene |
| PubChem CID | 15716524 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene |
| SMILES | C1CCCC2=C(CC1)C1CCC2O1 |
| InChI | InChI=1S/C12H18O/c1-2-4-6-10-9(5-3-1)11-7-8-12(10)13-11/h11-12H,1-8H2 |
| InChIKey | XLOPODWUJGKXKF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene?
The IUPAC name of 13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene (CID 15716524) is 13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene.
What is the SMILES notation for 13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene?
The canonical SMILES for 13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene is C1CCCC2=C(CC1)C1CCC2O1.
What is the InChIKey of 13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene?
The InChIKey is XLOPODWUJGKXKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-2-4-6-10-9(5-3-1)11-7-8-12(10)13-11/h11-12H,1-8H2.
What are the key properties of 13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene?
13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene has a molecular weight of 178.27 g/mol, XLogP of 3.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 13-oxatricyclo[8.2.1.02,9]tridec-2(9)-ene is sourced from PubChem (CID 15716524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).