C52H36Br4N4O2 — CID 157166516
1,2-bis(4-bromophenyl)ethane-1,2-dione;2,3-bis(4-bromophenyl)-6-phenylquinoxaline;4-phenylbenzene-1,2-diamine (PubChem CID 157166516) has the molecular formula C52H36Br4N4O2 and a molecular weight of 1068.50 g/mol. Its IUPAC name is 1,2-bis(4-bromophenyl)ethane-1,2-dione;2,3-bis(4-bromophenyl)-6-phenylquinoxaline;4-phenylbenzene-1,2-diamine.
| Compound Name | 1,2-bis(4-bromophenyl)ethane-1,2-dione;2,3-bis(4-bromophenyl)-6-phenylquinoxaline;4-phenylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 157166516 |
| Molecular Formula | C52H36Br4N4O2 |
| Molecular Weight | 1068.50 g/mol |
| Exact Mass | 1063.96 |
| IUPAC Name | 1,2-bis(4-bromophenyl)ethane-1,2-dione;2,3-bis(4-bromophenyl)-6-phenylquinoxaline;4-phenylbenzene-1,2-diamine |
| SMILES | Brc1ccc(-c2nc3ccc(-c4ccccc4)cc3nc2-c2ccc(Br)cc2)cc1.Nc1ccc(-c2ccccc2)cc1N.O=C(C(=O)c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H16Br2N2.C14H8Br2O2.C12H12N2/c27-21-11-6-18(7-12-21)25-26(19-8-13-22(28)14-9-19)30-24-16-20(10-15-23(24)29-25)17-4-2-1-3-5-17;15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10;13-11-7-6-10(8-12(11)14)9-4-2-1-3-5-9/h1-16H;1-8H;1-8H,13-14H2 |
| InChIKey | AMYZDGAFCDXMBS-UHFFFAOYSA-N |
| XLogP | 14.95 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1068.50 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|