C31H42F3N3O2 — CID 157167640
2-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-hydroxy-2,2,6,6-tetramethyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-1-(5-methyl-1H-imidazol-2-yl)ethanone (PubChem CID 157167640) has the molecular formula C31H42F3N3O2 and a molecular weight of 545.69 g/mol. Its IUPAC name is 2-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-hydroxy-2,2,6,6-tetramethyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-1-(5-methyl-1H-imidazol-2-yl)ethanone.
| Compound Name | 2-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-hydroxy-2,2,6,6-tetramethyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-1-(5-methyl-1H-imidazol-2-yl)ethanone |
|---|---|
| PubChem CID | 157167640 |
| Molecular Formula | C31H42F3N3O2 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.32 |
| IUPAC Name | 2-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-hydroxy-2,2,6,6-tetramethyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-1-(5-methyl-1H-imidazol-2-yl)ethanone |
| SMILES | Cc1cnc(C(=O)Cc2ccc(C3(O)CC(C)(C)N(CC(F)(F)F)C(C)(C)C3)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C31H42F3N3O2/c1-20-16-35-26(36-20)25(38)14-22-8-9-23(15-24(22)21-10-12-27(2,3)13-11-21)30(39)17-28(4,5)37(19-31(32,33)34)29(6,7)18-30/h8-10,15-16,39H,11-14,17-19H2,1-7H3,(H,35,36) |
| InChIKey | KKKHYPXVZVRLCG-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |