C28H21N5S2 — CID 157168054
2,3-dihydro-1H-indole;3,8-dithia-13,16-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),4,7(11),9,12,14-heptaene;quinoxaline (PubChem CID 157168054) has the molecular formula C28H21N5S2 and a molecular weight of 491.65 g/mol. Its IUPAC name is 2,3-dihydro-1H-indole;3,8-dithia-13,16-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),4,7(11),9,12,14-heptaene;quinoxaline.
| Compound Name | 2,3-dihydro-1H-indole;3,8-dithia-13,16-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),4,7(11),9,12,14-heptaene;quinoxaline |
|---|---|
| PubChem CID | 157168054 |
| Molecular Formula | C28H21N5S2 |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 2,3-dihydro-1H-indole;3,8-dithia-13,16-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),4,7(11),9,12,14-heptaene;quinoxaline |
| SMILES | c1ccc2c(c1)CCN2.c1ccc2nccnc2c1.c1cnc2c(n1)c1ccsc1c1ccsc12 |
| InChI | InChI=1S/C12H6N2S2.C8H6N2.C8H9N/c1-5-15-11-7(1)9-10(14-4-3-13-9)12-8(11)2-6-16-12;1-2-4-8-7(3-1)9-5-6-10-8;1-2-4-8-7(3-1)5-6-9-8/h1-6H;1-6H;1-4,9H,5-6H2 |
| InChIKey | ANDKYUZAJVGDLJ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |