About 8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one
8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 15716847) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
Molecular Properties
| Compound Name | 8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| PubChem CID | 15716847 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | CC12CCCN1C(=O)CC2 |
| InChI | InChI=1S/C8H13NO/c1-8-4-2-6-9(8)7(10)3-5-8/h2-6H2,1H3 |
| InChIKey | FSVVYIAVWCTTTL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The IUPAC name of 8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (CID 15716847) is 8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
What is the SMILES notation for 8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The canonical SMILES for 8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one is CC12CCCN1C(=O)CC2.
What is the InChIKey of 8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The InChIKey is FSVVYIAVWCTTTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-8-4-2-6-9(8)7(10)3-5-8/h2-6H2,1H3.
What are the key properties of 8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one has a molecular weight of 139.20 g/mol, XLogP of 1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one is sourced from PubChem (CID 15716847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).