C20H32O4 — CID 157168817
(2S)-3,3-dimethyl-2-[2-oxo-2-[[(2S,3R)-2-pent-4-enyl-3-bicyclo[3.1.1]heptanyl]oxy]ethyl]butanoic acid (PubChem CID 157168817) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-[2-oxo-2-[[(2S,3R)-2-pent-4-enyl-3-bicyclo[3.1.1]heptanyl]oxy]ethyl]butanoic acid.
| Compound Name | (2S)-3,3-dimethyl-2-[2-oxo-2-[[(2S,3R)-2-pent-4-enyl-3-bicyclo[3.1.1]heptanyl]oxy]ethyl]butanoic acid |
|---|---|
| PubChem CID | 157168817 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (2S)-3,3-dimethyl-2-[2-oxo-2-[[(2S,3R)-2-pent-4-enyl-3-bicyclo[3.1.1]heptanyl]oxy]ethyl]butanoic acid |
| SMILES | C=CCCC[C@H]1C2CC(C2)C[C@H]1OC(=O)C[C@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C20H32O4/c1-5-6-7-8-15-14-9-13(10-14)11-17(15)24-18(21)12-16(19(22)23)20(2,3)4/h5,13-17H,1,6-12H2,2-4H3,(H,22,23)/t13?,14?,15-,16+,17+/m0/s1 |
| InChIKey | XTLVUWSUTSAPEO-IRKLFDGPSA-N |
| XLogP | 4.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|