About methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate
methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate (PubChem CID 157168866) has the molecular formula C19H20N4O5
and a molecular weight of 384.39 g/mol. Its IUPAC name is methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate |
| PubChem CID | 157168866 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1cc2cc(NC(=O)c3nc(C)cn3C)ccc2o1 |
| InChI | InChI=1S/C19H20N4O5/c1-11-10-23(2)17(21-11)19(26)22-13-4-5-14-12(8-13)9-15(28-14)18(25)20-7-6-16(24)27-3/h4-5,8-10H,6-7H2,1-3H3,(H,20,25)(H,22,26) |
| InChIKey | FPFYDVPFPFDTTR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate?
The IUPAC name of methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate (CID 157168866) is methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate.
What is the SMILES notation for methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate?
The canonical SMILES for methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate is COC(=O)CCNC(=O)c1cc2cc(NC(=O)c3nc(C)cn3C)ccc2o1.
What is the InChIKey of methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate?
The InChIKey is FPFYDVPFPFDTTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O5/c1-11-10-23(2)17(21-11)19(26)22-13-4-5-14-12(8-13)9-15(28-14)18(25)20-7-6-16(24)27-3/h4-5,8-10H,6-7H2,1-3H3,(H,20,25)(H,22,26).
What are the key properties of methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate?
methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate has a molecular weight of 384.39 g/mol, XLogP of 2.02, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[5-[(1,4-dimethylimidazole-2-carbonyl)amino]-1-benzofuran-2-carbonyl]amino]propanoate is sourced from PubChem (CID 157168866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).