C31H41NO5Si — CID 157168975
(2R,4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dioxoisoindol-2-yl)propyl]-4-methyl-3-(2-phenylethyl)oxolane-2-carbaldehyde (PubChem CID 157168975) has the molecular formula C31H41NO5Si and a molecular weight of 535.76 g/mol. Its IUPAC name is (2R,4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dioxoisoindol-2-yl)propyl]-4-methyl-3-(2-phenylethyl)oxolane-2-carbaldehyde.
| Compound Name | (2R,4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dioxoisoindol-2-yl)propyl]-4-methyl-3-(2-phenylethyl)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 157168975 |
| Molecular Formula | C31H41NO5Si |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | (2R,4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dioxoisoindol-2-yl)propyl]-4-methyl-3-(2-phenylethyl)oxolane-2-carbaldehyde |
| SMILES | C[C@@H]1C(CCc2ccccc2)[C@H](C=O)O[C@@H]1CC(CN1C(=O)c2ccccc2C1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H41NO5Si/c1-21-24(17-16-22-12-8-7-9-13-22)28(20-33)36-27(21)18-23(37-38(5,6)31(2,3)4)19-32-29(34)25-14-10-11-15-26(25)30(32)35/h7-15,20-21,23-24,27-28H,16-19H2,1-6H3/t21-,23?,24?,27-,28+/m1/s1 |
| InChIKey | XPWQXIDHSCXRQY-NQHKCWONSA-N |
| XLogP | 5.91 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|