About CID 157171964
CID 157171964 (PubChem CID 157171964) has the molecular formula C15H20BCl3IrN2Si
and a molecular weight of 565.81 g/mol.
Molecular Properties
| Compound Name | CID 157171964 |
| PubChem CID | 157171964 |
| Molecular Formula | C15H20BCl3IrN2Si |
| Molecular Weight | 565.81 g/mol |
| Exact Mass | 565.02 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2ccc([Si](C)(C)C)cn2)c(C)n1.Cl[Ir](Cl)Cl.[B] |
| InChI | InChI=1S/C15H20N2Si.B.3ClH.Ir/c1-11-6-8-14(12(2)17-11)15-9-7-13(10-16-15)18(3,4)5;;;;;/h6-10H,1-5H3;;3*1H;/q;;;;;+3/p-3 |
| InChIKey | YECJAMJPZAZDCF-UHFFFAOYSA-K |
| XLogP | 4.99 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 565.81 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 157171964 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157171964?
The IUPAC name of CID 157171964 (CID 157171964) is not available.
What is the SMILES notation for CID 157171964?
The canonical SMILES for CID 157171964 is Cc1ccc(-c2ccc([Si](C)(C)C)cn2)c(C)n1.Cl[Ir](Cl)Cl.[B].
What is the InChIKey of CID 157171964?
The InChIKey is YECJAMJPZAZDCF-UHFFFAOYSA-K. The full InChI is InChI=1S/C15H20N2Si.B.3ClH.Ir/c1-11-6-8-14(12(2)17-11)15-9-7-13(10-16-15)18(3,4)5;;;;;/h6-10H,1-5H3;;3*1H;/q;;;;;+3/p-3.
What are the key properties of CID 157171964?
CID 157171964 has a molecular weight of 565.81 g/mol, XLogP of 4.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157171964 is sourced from PubChem (CID 157171964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).