C11H17N5 — CID 157171986
2-N-cyclopenta-1,4-dien-1-yl-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine (PubChem CID 157171986) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-N-cyclopenta-1,4-dien-1-yl-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine.
| Compound Name | 2-N-cyclopenta-1,4-dien-1-yl-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 157171986 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-N-cyclopenta-1,4-dien-1-yl-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| SMILES | CC1N=C(NC2=CCC=C2)NC(N(C)C)=N1 |
| InChI | InChI=1S/C11H17N5/c1-8-12-10(14-9-6-4-5-7-9)15-11(13-8)16(2)3/h4,6-8H,5H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | BPOIALCWADWAEX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |