C33H39IN2O5 — CID 157172253
tert-butyl 2-[6-[4-(2-iodoethoxy)phenyl]-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6H-phenanthridin-8-yl]acetate (PubChem CID 157172253) has the molecular formula C33H39IN2O5 and a molecular weight of 670.59 g/mol. Its IUPAC name is tert-butyl 2-[6-[4-(2-iodoethoxy)phenyl]-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6H-phenanthridin-8-yl]acetate.
| Compound Name | tert-butyl 2-[6-[4-(2-iodoethoxy)phenyl]-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6H-phenanthridin-8-yl]acetate |
|---|---|
| PubChem CID | 157172253 |
| Molecular Formula | C33H39IN2O5 |
| Molecular Weight | 670.59 g/mol |
| Exact Mass | 670.19 |
| IUPAC Name | tert-butyl 2-[6-[4-(2-iodoethoxy)phenyl]-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6H-phenanthridin-8-yl]acetate |
| SMILES | CN1c2cc(NC(=O)OC(C)(C)C)ccc2-c2ccc(CC(=O)OC(C)(C)C)cc2C1c1ccc(OCCI)cc1 |
| InChI | InChI=1S/C33H39IN2O5/c1-32(2,3)40-29(37)19-21-8-14-25-26-15-11-23(35-31(38)41-33(4,5)6)20-28(26)36(7)30(27(25)18-21)22-9-12-24(13-10-22)39-17-16-34/h8-15,18,20,30H,16-17,19H2,1-7H3,(H,35,38) |
| InChIKey | ANPJLBSIWXCFBQ-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.59 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|