C8H4F14 — CID 15717412
1,1,1,2,2,3,3,6-octafluoro-4,4-bis(trifluoromethyl)hexane (PubChem CID 15717412) has the molecular formula C8H4F14 and a molecular weight of 366.09 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,6-octafluoro-4,4-bis(trifluoromethyl)hexane.
| Compound Name | 1,1,1,2,2,3,3,6-octafluoro-4,4-bis(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 15717412 |
| Molecular Formula | C8H4F14 |
| Molecular Weight | 366.09 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 1,1,1,2,2,3,3,6-octafluoro-4,4-bis(trifluoromethyl)hexane |
| SMILES | FCCC(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F14/c9-2-1-3(6(14,15)16,7(17,18)19)4(10,11)5(12,13)8(20,21)22/h1-2H2 |
| InChIKey | YNZKTDDDSLBHKF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.09 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|