C8H2F16 — CID 15717414
1,1,1,2,2,3,3,5,6,6-decafluoro-4,4-bis(trifluoromethyl)hexane (PubChem CID 15717414) has the molecular formula C8H2F16 and a molecular weight of 402.07 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,5,6,6-decafluoro-4,4-bis(trifluoromethyl)hexane.
| Compound Name | 1,1,1,2,2,3,3,5,6,6-decafluoro-4,4-bis(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 15717414 |
| Molecular Formula | C8H2F16 |
| Molecular Weight | 402.07 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 1,1,1,2,2,3,3,5,6,6-decafluoro-4,4-bis(trifluoromethyl)hexane |
| SMILES | FC(F)C(F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F16/c9-1(2(10)11)3(6(16,17)18,7(19,20)21)4(12,13)5(14,15)8(22,23)24/h1-2H |
| InChIKey | XEZPFXNWHCGJSJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.07 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|