C8HF17 — CID 15717416
1,1,1,2,2,3,3,5,6,6,6-undecafluoro-4,4-bis(trifluoromethyl)hexane (PubChem CID 15717416) has the molecular formula C8HF17 and a molecular weight of 420.06 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,5,6,6,6-undecafluoro-4,4-bis(trifluoromethyl)hexane.
| Compound Name | 1,1,1,2,2,3,3,5,6,6,6-undecafluoro-4,4-bis(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 15717416 |
| Molecular Formula | C8HF17 |
| Molecular Weight | 420.06 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | 1,1,1,2,2,3,3,5,6,6,6-undecafluoro-4,4-bis(trifluoromethyl)hexane |
| SMILES | FC(C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8HF17/c9-1(3(10,11)12)2(6(17,18)19,7(20,21)22)4(13,14)5(15,16)8(23,24)25/h1H |
| InChIKey | JKCQJJNDRAABBM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.06 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|