C30H32BBrN2O2 — CID 157174634
2-bromopyridine;5,6,7,8-tetrahydronaphthalen-2-ylboronic acid;2-(5,6,7,8-tetrahydronaphthalen-2-yl)pyridine (PubChem CID 157174634) has the molecular formula C30H32BBrN2O2 and a molecular weight of 543.31 g/mol. Its IUPAC name is 2-bromopyridine;5,6,7,8-tetrahydronaphthalen-2-ylboronic acid;2-(5,6,7,8-tetrahydronaphthalen-2-yl)pyridine.
| Compound Name | 2-bromopyridine;5,6,7,8-tetrahydronaphthalen-2-ylboronic acid;2-(5,6,7,8-tetrahydronaphthalen-2-yl)pyridine |
|---|---|
| PubChem CID | 157174634 |
| Molecular Formula | C30H32BBrN2O2 |
| Molecular Weight | 543.31 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 2-bromopyridine;5,6,7,8-tetrahydronaphthalen-2-ylboronic acid;2-(5,6,7,8-tetrahydronaphthalen-2-yl)pyridine |
| SMILES | Brc1ccccn1.OB(O)c1ccc2c(c1)CCCC2.c1ccc(-c2ccc3c(c2)CCCC3)nc1 |
| InChI | InChI=1S/C15H15N.C10H13BO2.C5H4BrN/c1-2-6-13-11-14(9-8-12(13)5-1)15-7-3-4-10-16-15;12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;6-5-3-1-2-4-7-5/h3-4,7-11H,1-2,5-6H2;5-7,12-13H,1-4H2;1-4H |
| InChIKey | ANWCJZKHNKMTFV-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.31 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|