About chlorosilane;dichloro(methyl)silane
chlorosilane;dichloro(methyl)silane (PubChem CID 157174835) has the molecular formula CH7Cl3Si2
and a molecular weight of 181.60 g/mol. Its IUPAC name is chlorosilane;dichloro(methyl)silane.
Molecular Properties
| Compound Name | chlorosilane;dichloro(methyl)silane |
| PubChem CID | 157174835 |
| Molecular Formula | CH7Cl3Si2 |
| Molecular Weight | 181.60 g/mol |
| Exact Mass | 179.92 |
| IUPAC Name | chlorosilane;dichloro(methyl)silane |
| SMILES | C[SiH](Cl)Cl.[SiH3]Cl |
| InChI | InChI=1S/CH4Cl2Si.ClH3Si/c1-4(2)3;1-2/h4H,1H3;2H3 |
| InChIKey | ANWSFGJAYCTUCK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.60 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chlorosilane;dichloro(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosilane;dichloro(methyl)silane?
The IUPAC name of chlorosilane;dichloro(methyl)silane (CID 157174835) is chlorosilane;dichloro(methyl)silane.
What is the SMILES notation for chlorosilane;dichloro(methyl)silane?
The canonical SMILES for chlorosilane;dichloro(methyl)silane is C[SiH](Cl)Cl.[SiH3]Cl.
What is the InChIKey of chlorosilane;dichloro(methyl)silane?
The InChIKey is ANWSFGJAYCTUCK-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4Cl2Si.ClH3Si/c1-4(2)3;1-2/h4H,1H3;2H3.
What are the key properties of chlorosilane;dichloro(methyl)silane?
chlorosilane;dichloro(methyl)silane has a molecular weight of 181.60 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosilane;dichloro(methyl)silane is sourced from PubChem (CID 157174835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).