About CID 157175310
CID 157175310 (PubChem CID 157175310) has the molecular formula C28H25BN2O2
and a molecular weight of 432.33 g/mol.
Molecular Properties
| Compound Name | CID 157175310 |
| PubChem CID | 157175310 |
| Molecular Formula | C28H25BN2O2 |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2cc(C3=CN=C([C@@H]4CC5(CC5)CN4C(=O)OCc4ccccc4)C3)ccc2c1 |
| InChI | InChI=1S/C28H25BN2O2/c29-24-9-8-20-12-21(6-7-22(20)13-24)23-14-25(30-16-23)26-15-28(10-11-28)18-31(26)27(32)33-17-19-4-2-1-3-5-19/h1-9,12-13,16,26H,10-11,14-15,17-18H2/t26-/m0/s1 |
| InChIKey | OSZFCWSREJHOKN-SANMLTNESA-N |
| XLogP | 5.01 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 157175310 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157175310?
The IUPAC name of CID 157175310 (CID 157175310) is not available.
What is the SMILES notation for CID 157175310?
The canonical SMILES for CID 157175310 is [B]c1ccc2cc(C3=CN=C([C@@H]4CC5(CC5)CN4C(=O)OCc4ccccc4)C3)ccc2c1.
What is the InChIKey of CID 157175310?
The InChIKey is OSZFCWSREJHOKN-SANMLTNESA-N. The full InChI is InChI=1S/C28H25BN2O2/c29-24-9-8-20-12-21(6-7-22(20)13-24)23-14-25(30-16-23)26-15-28(10-11-28)18-31(26)27(32)33-17-19-4-2-1-3-5-19/h1-9,12-13,16,26H,10-11,14-15,17-18H2/t26-/m0/s1.
What are the key properties of CID 157175310?
CID 157175310 has a molecular weight of 432.33 g/mol, XLogP of 5.01, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157175310 is sourced from PubChem (CID 157175310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).