C33H39BN2O4 — CID 157175826
4,6-dimethyl-3-[3-[2-methyl-1-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]indol-3-yl]-3-oxopropyl]-1H-pyridin-2-one (PubChem CID 157175826) has the molecular formula C33H39BN2O4 and a molecular weight of 538.50 g/mol. Its IUPAC name is 4,6-dimethyl-3-[3-[2-methyl-1-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]indol-3-yl]-3-oxopropyl]-1H-pyridin-2-one.
| Compound Name | 4,6-dimethyl-3-[3-[2-methyl-1-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]indol-3-yl]-3-oxopropyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 157175826 |
| Molecular Formula | C33H39BN2O4 |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | 4,6-dimethyl-3-[3-[2-methyl-1-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]indol-3-yl]-3-oxopropyl]-1H-pyridin-2-one |
| SMILES | Cc1cc(C)c(CCC(=O)c2c(C)n(C(C)c3cccc(B4OC(C)(C)C(C)(C)O4)c3)c3ccccc23)c(=O)[nH]1 |
| InChI | InChI=1S/C33H39BN2O4/c1-20-18-21(2)35-31(38)26(20)16-17-29(37)30-23(4)36(28-15-10-9-14-27(28)30)22(3)24-12-11-13-25(19-24)34-39-32(5,6)33(7,8)40-34/h9-15,18-19,22H,16-17H2,1-8H3,(H,35,38) |
| InChIKey | XFMXXAFEKUJAJA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|