C20H11Br9O3 — CID 157176103
2,3,4-tribromophenol;1,2,3-tribromo-4-[1-(2,3,4-tribromophenoxy)ethoxy]benzene (PubChem CID 157176103) has the molecular formula C20H11Br9O3 and a molecular weight of 1018.44 g/mol. Its IUPAC name is 2,3,4-tribromophenol;1,2,3-tribromo-4-[1-(2,3,4-tribromophenoxy)ethoxy]benzene.
| Compound Name | 2,3,4-tribromophenol;1,2,3-tribromo-4-[1-(2,3,4-tribromophenoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 157176103 |
| Molecular Formula | C20H11Br9O3 |
| Molecular Weight | 1018.44 g/mol |
| Exact Mass | 1009.34 |
| IUPAC Name | 2,3,4-tribromophenol;1,2,3-tribromo-4-[1-(2,3,4-tribromophenoxy)ethoxy]benzene |
| SMILES | CC(Oc1ccc(Br)c(Br)c1Br)Oc1ccc(Br)c(Br)c1Br.Oc1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C14H8Br6O2.C6H3Br3O/c1-6(21-9-4-2-7(15)11(17)13(9)19)22-10-5-3-8(16)12(18)14(10)20;7-3-1-2-4(10)6(9)5(3)8/h2-6H,1H3;1-2,10H |
| InChIKey | AOAFEYDHSGCFRS-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1018.44 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|