About 2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane
2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane (PubChem CID 157177616) has the molecular formula C16H32O4
and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane |
| PubChem CID | 157177616 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane |
| SMILES | CC(C)(C)C1OCCO1.CCC1COC(C(C)(C)C)O1 |
| InChI | InChI=1S/C9H18O2.C7H14O2/c1-5-7-6-10-8(11-7)9(2,3)4;1-7(2,3)6-8-4-5-9-6/h7-8H,5-6H2,1-4H3;6H,4-5H2,1-3H3 |
| InChIKey | AOEUTLQKBNUFJU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane?
The IUPAC name of 2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane (CID 157177616) is 2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane.
What is the SMILES notation for 2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane?
The canonical SMILES for 2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane is CC(C)(C)C1OCCO1.CCC1COC(C(C)(C)C)O1.
What is the InChIKey of 2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane?
The InChIKey is AOEUTLQKBNUFJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2.C7H14O2/c1-5-7-6-10-8(11-7)9(2,3)4;1-7(2,3)6-8-4-5-9-6/h7-8H,5-6H2,1-4H3;6H,4-5H2,1-3H3.
What are the key properties of 2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane?
2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane has a molecular weight of 288.43 g/mol, XLogP of 3.59, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,3-dioxolane;2-tert-butyl-4-ethyl-1,3-dioxolane is sourced from PubChem (CID 157177616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).