C20H17ClN4O4S — CID 157177666
N-[4-[2-[3-amino-6-(4-chlorophenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide (PubChem CID 157177666) has the molecular formula C20H17ClN4O4S and a molecular weight of 444.90 g/mol. Its IUPAC name is N-[4-[2-[3-amino-6-(4-chlorophenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[2-[3-amino-6-(4-chlorophenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 157177666 |
| Molecular Formula | C20H17ClN4O4S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | N-[4-[2-[3-amino-6-(4-chlorophenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(CC(=O)c2nc(-c3ccc(Cl)cc3)cnc2N)cc1 |
| InChI | InChI=1S/C20H17ClN4O4S/c1-12(26)25-30(28,29)16-8-2-13(3-9-16)10-18(27)19-20(22)23-11-17(24-19)14-4-6-15(21)7-5-14/h2-9,11H,10H2,1H3,(H2,22,23)(H,25,26) |
| InChIKey | AOEYJIKGJKHQIO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |