C6H14Si — CID 157178624
dimethyl(prop-1-ynyl)silane;methane (PubChem CID 157178624) has the molecular formula C6H14Si and a molecular weight of 114.26 g/mol. Its IUPAC name is dimethyl(prop-1-ynyl)silane;methane.
| Compound Name | dimethyl(prop-1-ynyl)silane;methane |
|---|---|
| PubChem CID | 157178624 |
| Molecular Formula | C6H14Si |
| Molecular Weight | 114.26 g/mol |
| Exact Mass | 114.09 |
| IUPAC Name | dimethyl(prop-1-ynyl)silane;methane |
| SMILES | C.CC#C[SiH](C)C |
| InChI | InChI=1S/C5H10Si.CH4/c1-4-5-6(2)3;/h6H,1-3H3;1H4 |
| InChIKey | AOHUHAKYZXFMQB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|