C62H74 — CID 157179117
1,3-diphenylbenzene;ethane;1-phenylnaphthalene;2-phenylnaphthalene (PubChem CID 157179117) has the molecular formula C62H74 and a molecular weight of 819.27 g/mol. Its IUPAC name is 1,3-diphenylbenzene;ethane;1-phenylnaphthalene;2-phenylnaphthalene.
| Compound Name | 1,3-diphenylbenzene;ethane;1-phenylnaphthalene;2-phenylnaphthalene |
|---|---|
| PubChem CID | 157179117 |
| Molecular Formula | C62H74 |
| Molecular Weight | 819.27 g/mol |
| Exact Mass | 818.58 |
| IUPAC Name | 1,3-diphenylbenzene;ethane;1-phenylnaphthalene;2-phenylnaphthalene |
| SMILES | CC.CC.CC.CC.CC.CC.c1ccc(-c2ccc3ccccc3c2)cc1.c1ccc(-c2cccc(-c3ccccc3)c2)cc1.c1ccc(-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C18H14.2C16H12.6C2H6/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16;1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16;1-2-6-13(7-3-1)16-11-10-14-8-4-5-9-15(14)12-16;6*1-2/h1-14H;2*1-12H;6*1-2H3 |
| InChIKey | AOJCGIFBVOLGDY-UHFFFAOYSA-N |
| XLogP | 20.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.27 |
| LogP ≤ 5 | 20.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |