About benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid
benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid (PubChem CID 157181447) has the molecular formula C31H32O8
and a molecular weight of 532.59 g/mol. Its IUPAC name is benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid.
Molecular Properties
| Compound Name | benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid |
| PubChem CID | 157181447 |
| Molecular Formula | C31H32O8 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid |
| SMILES | COC(=O)C=Cc1ccc(C(=O)OCc2ccccc2)cc1C.COC(=O)CCc1ccc(C(=O)O)cc1C |
| InChI | InChI=1S/C19H18O4.C12H14O4/c1-14-12-17(9-8-16(14)10-11-18(20)22-2)19(21)23-13-15-6-4-3-5-7-15;1-8-7-10(12(14)15)4-3-9(8)5-6-11(13)16-2/h3-12H,13H2,1-2H3;3-4,7H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | AOPPWHITPWWDIK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid?
The IUPAC name of benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid (CID 157181447) is benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid.
What is the SMILES notation for benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid?
The canonical SMILES for benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid is COC(=O)C=Cc1ccc(C(=O)OCc2ccccc2)cc1C.COC(=O)CCc1ccc(C(=O)O)cc1C.
What is the InChIKey of benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid?
The InChIKey is AOPPWHITPWWDIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O4.C12H14O4/c1-14-12-17(9-8-16(14)10-11-18(20)22-2)19(21)23-13-15-6-4-3-5-7-15;1-8-7-10(12(14)15)4-3-9(8)5-6-11(13)16-2/h3-12H,13H2,1-2H3;3-4,7H,5-6H2,1-2H3,(H,14,15).
What are the key properties of benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid?
benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid has a molecular weight of 532.59 g/mol, XLogP of 5.34, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(3-methoxy-3-oxoprop-1-enyl)-3-methylbenzoate;4-(3-methoxy-3-oxopropyl)-3-methylbenzoic acid is sourced from PubChem (CID 157181447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).