C28H56O2 — CID 157181947
tert-butylcyclohexane;2-tert-butyloxane;3-tert-butyloxane (PubChem CID 157181947) has the molecular formula C28H56O2 and a molecular weight of 424.75 g/mol. Its IUPAC name is tert-butylcyclohexane;2-tert-butyloxane;3-tert-butyloxane.
| Compound Name | tert-butylcyclohexane;2-tert-butyloxane;3-tert-butyloxane |
|---|---|
| PubChem CID | 157181947 |
| Molecular Formula | C28H56O2 |
| Molecular Weight | 424.75 g/mol |
| Exact Mass | 424.43 |
| IUPAC Name | tert-butylcyclohexane;2-tert-butyloxane;3-tert-butyloxane |
| SMILES | CC(C)(C)C1CCCCC1.CC(C)(C)C1CCCCO1.CC(C)(C)C1CCCOC1 |
| InChI | InChI=1S/C10H20.2C9H18O/c1-10(2,3)9-7-5-4-6-8-9;1-9(2,3)8-5-4-6-10-7-8;1-9(2,3)8-6-4-5-7-10-8/h9H,4-8H2,1-3H3;2*8H,4-7H2,1-3H3 |
| InChIKey | AOQZRZJNJIFONT-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.75 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |