About ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen
ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen (PubChem CID 157183095) has the molecular formula C16H30O2
and a molecular weight of 254.41 g/mol. Its IUPAC name is ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen.
Molecular Properties
| Compound Name | ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen |
| PubChem CID | 157183095 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen |
| SMILES | C=COC(=O)C1CCC(C2CCC(C)CC2)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C16H26O2.2H2/c1-3-18-16(17)15-10-8-14(9-11-15)13-6-4-12(2)5-7-13;;/h3,12-15H,1,4-11H2,2H3;2*1H |
| InChIKey | AOUDTIDJMNRTLA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen?
The IUPAC name of ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen (CID 157183095) is ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen.
What is the SMILES notation for ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen?
The canonical SMILES for ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen is C=COC(=O)C1CCC(C2CCC(C)CC2)CC1.[H][H].[H][H].
What is the InChIKey of ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen?
The InChIKey is AOUDTIDJMNRTLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2.2H2/c1-3-18-16(17)15-10-8-14(9-11-15)13-6-4-12(2)5-7-13;;/h3,12-15H,1,4-11H2,2H3;2*1H.
What are the key properties of ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen?
ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen has a molecular weight of 254.41 g/mol, XLogP of 4.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate;molecular hydrogen is sourced from PubChem (CID 157183095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).