C25H44N2O9 — CID 157183253
1-O-tert-butyl 2-O-methyl (2S,4S,5S)-4,5-dimethylpyrrolidine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S,4S,5S)-4-hydroxy-5-methylpyrrolidine-1,2-dicarboxylate (PubChem CID 157183253) has the molecular formula C25H44N2O9 and a molecular weight of 516.63 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4S,5S)-4,5-dimethylpyrrolidine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S,4S,5S)-4-hydroxy-5-methylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4S,5S)-4,5-dimethylpyrrolidine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S,4S,5S)-4-hydroxy-5-methylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 157183253 |
| Molecular Formula | C25H44N2O9 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4S,5S)-4,5-dimethylpyrrolidine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S,4S,5S)-4-hydroxy-5-methylpyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](C)[C@H](C)N1C(=O)OC(C)(C)C.COC(=O)[C@@H]1C[C@H](O)[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO4.C12H21NO5/c1-8-7-10(11(15)17-6)14(9(8)2)12(16)18-13(3,4)5;1-7-9(14)6-8(10(15)17-5)13(7)11(16)18-12(2,3)4/h8-10H,7H2,1-6H3;7-9,14H,6H2,1-5H3/t8-,9-,10-;7-,8-,9-/m00/s1 |
| InChIKey | AOUQBSCRUWVXMP-RSTJMHLGSA-N |
| XLogP | 3.11 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|