C16H22N2 — CID 157183608
2,3,5,6,7-pentamethyl-8-propan-2-ylquinoxaline (PubChem CID 157183608) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2,3,5,6,7-pentamethyl-8-propan-2-ylquinoxaline.
| Compound Name | 2,3,5,6,7-pentamethyl-8-propan-2-ylquinoxaline |
|---|---|
| PubChem CID | 157183608 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2,3,5,6,7-pentamethyl-8-propan-2-ylquinoxaline |
| SMILES | Cc1nc2c(C)c(C)c(C)c(C(C)C)c2nc1C |
| InChI | InChI=1S/C16H22N2/c1-8(2)14-10(4)9(3)11(5)15-16(14)18-13(7)12(6)17-15/h8H,1-7H3 |
| InChIKey | VWMJJLPGLIGDPL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |