C15H29F3O4S — CID 157183639
2,2-difluoro-2-fluorosulfonylacetic acid;2,2-dimethylundecane (PubChem CID 157183639) has the molecular formula C15H29F3O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 2,2-difluoro-2-fluorosulfonylacetic acid;2,2-dimethylundecane.
| Compound Name | 2,2-difluoro-2-fluorosulfonylacetic acid;2,2-dimethylundecane |
|---|---|
| PubChem CID | 157183639 |
| Molecular Formula | C15H29F3O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2,2-difluoro-2-fluorosulfonylacetic acid;2,2-dimethylundecane |
| SMILES | CCCCCCCCCC(C)(C)C.O=C(O)C(F)(F)S(=O)(=O)F |
| InChI | InChI=1S/C13H28.C2HF3O4S/c1-5-6-7-8-9-10-11-12-13(2,3)4;3-2(4,1(6)7)10(5,8)9/h5-12H2,1-4H3;(H,6,7) |
| InChIKey | AOVXHJZBYJRTEL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|