C19H19N5S — CID 157183778
4-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]-1H-pyrrolo[2,3-c]pyridin-5-amine;methanethiol (PubChem CID 157183778) has the molecular formula C19H19N5S and a molecular weight of 349.46 g/mol. Its IUPAC name is 4-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]-1H-pyrrolo[2,3-c]pyridin-5-amine;methanethiol.
| Compound Name | 4-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]-1H-pyrrolo[2,3-c]pyridin-5-amine;methanethiol |
|---|---|
| PubChem CID | 157183778 |
| Molecular Formula | C19H19N5S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 4-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]-1H-pyrrolo[2,3-c]pyridin-5-amine;methanethiol |
| SMILES | CS.Nc1ncc2[nH]ccc2c1C#Cc1ccc(C2=NCCN2)cc1 |
| InChI | InChI=1S/C18H15N5.CH4S/c19-17-15(14-7-8-20-16(14)11-23-17)6-3-12-1-4-13(5-2-12)18-21-9-10-22-18;1-2/h1-2,4-5,7-8,11,20H,9-10H2,(H2,19,23)(H,21,22);2H,1H3 |
| InChIKey | AOWIKUBVUBBERB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|