C27H31FN6O2 — CID 157183979
1-[3-[[[5-fluoro-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]but-3-en-2-one (PubChem CID 157183979) has the molecular formula C27H31FN6O2 and a molecular weight of 490.58 g/mol. Its IUPAC name is 1-[3-[[[5-fluoro-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[[[5-fluoro-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 157183979 |
| Molecular Formula | C27H31FN6O2 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 1-[3-[[[5-fluoro-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(CNc2nc(Nc3ccc(N4CCN(C)CC4)cc3OC)ncc2F)c1 |
| InChI | InChI=1S/C27H31FN6O2/c1-4-22(35)15-19-6-5-7-20(14-19)17-29-26-23(28)18-30-27(32-26)31-24-9-8-21(16-25(24)36-3)34-12-10-33(2)11-13-34/h4-9,14,16,18H,1,10-13,15,17H2,2-3H3,(H2,29,30,31,32) |
| InChIKey | DDLNWTOTXJBSEQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|