C22H25F5N2O3 — CID 157184033
(4aR,8aS)-6-[4-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 157184033) has the molecular formula C22H25F5N2O3 and a molecular weight of 460.44 g/mol. Its IUPAC name is (4aR,8aS)-6-[4-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[4-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 157184033 |
| Molecular Formula | C22H25F5N2O3 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (4aR,8aS)-6-[4-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CCC(Cc4c(F)cc(C(F)(F)F)cc4F)CC3)C[C@H]2C1 |
| InChI | InChI=1S/C22H25F5N2O3/c23-18-9-15(22(25,26)27)10-19(24)17(18)7-13-1-4-28(5-2-13)21(31)29-6-3-20-14(11-29)8-16(30)12-32-20/h9-10,13-14,20H,1-8,11-12H2/t14-,20+/m1/s1 |
| InChIKey | AOXANYIJPRBNNX-VLIAUNLRSA-N |
| XLogP | 4.04 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |