C14H28F3NO — CID 157184165
3-(decylamino)-1,1,1-trifluoro-2-methylpropan-2-ol (PubChem CID 157184165) has the molecular formula C14H28F3NO and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-(decylamino)-1,1,1-trifluoro-2-methylpropan-2-ol.
| Compound Name | 3-(decylamino)-1,1,1-trifluoro-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 157184165 |
| Molecular Formula | C14H28F3NO |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 3-(decylamino)-1,1,1-trifluoro-2-methylpropan-2-ol |
| SMILES | CCCCCCCCCCNCC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C14H28F3NO/c1-3-4-5-6-7-8-9-10-11-18-12-13(2,19)14(15,16)17/h18-19H,3-12H2,1-2H3 |
| InChIKey | BWFKISVLHKUBMJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|