About 1-ethylpiperidine;oxalic acid
1-ethylpiperidine;oxalic acid (PubChem CID 157184471) has the molecular formula C11H19NO8
and a molecular weight of 293.27 g/mol. Its IUPAC name is 1-ethylpiperidine;oxalic acid.
Molecular Properties
| Compound Name | 1-ethylpiperidine;oxalic acid |
| PubChem CID | 157184471 |
| Molecular Formula | C11H19NO8 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1-ethylpiperidine;oxalic acid |
| SMILES | CCN1CCCCC1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C7H15N.2C2H2O4/c1-2-8-6-4-3-5-7-8;2*3-1(4)2(5)6/h2-7H2,1H3;2*(H,3,4)(H,5,6) |
| InChIKey | AOYNRAYKYFLZIE-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylpiperidine;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpiperidine;oxalic acid?
The IUPAC name of 1-ethylpiperidine;oxalic acid (CID 157184471) is 1-ethylpiperidine;oxalic acid.
What is the SMILES notation for 1-ethylpiperidine;oxalic acid?
The canonical SMILES for 1-ethylpiperidine;oxalic acid is CCN1CCCCC1.O=C(O)C(=O)O.O=C(O)C(=O)O.
What is the InChIKey of 1-ethylpiperidine;oxalic acid?
The InChIKey is AOYNRAYKYFLZIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.2C2H2O4/c1-2-8-6-4-3-5-7-8;2*3-1(4)2(5)6/h2-7H2,1H3;2*(H,3,4)(H,5,6).
What are the key properties of 1-ethylpiperidine;oxalic acid?
1-ethylpiperidine;oxalic acid has a molecular weight of 293.27 g/mol, XLogP of -0.20, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpiperidine;oxalic acid is sourced from PubChem (CID 157184471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).