About ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid
ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid (PubChem CID 157184662) has the molecular formula C14H19NO4S
and a molecular weight of 297.38 g/mol. Its IUPAC name is ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 157184662 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
| SMILES | CC.C[C@]1(C(=O)O)CSC(c2cccc(CO)c2O)=N1 |
| InChI | InChI=1S/C12H13NO4S.C2H6/c1-12(11(16)17)6-18-10(13-12)8-4-2-3-7(5-14)9(8)15;1-2/h2-4,14-15H,5-6H2,1H3,(H,16,17);1-2H3/t12-;/m1./s1 |
| InChIKey | AOZBBGOJXYKNAA-UTONKHPSSA-N |
| XLogP | 2.25 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid?
The IUPAC name of ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid (CID 157184662) is ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid is CC.C[C@]1(C(=O)O)CSC(c2cccc(CO)c2O)=N1.
What is the InChIKey of ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid?
The InChIKey is AOZBBGOJXYKNAA-UTONKHPSSA-N. The full InChI is InChI=1S/C12H13NO4S.C2H6/c1-12(11(16)17)6-18-10(13-12)8-4-2-3-7(5-14)9(8)15;1-2/h2-4,14-15H,5-6H2,1H3,(H,16,17);1-2H3/t12-;/m1./s1.
What are the key properties of ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid?
ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid has a molecular weight of 297.38 g/mol, XLogP of 2.25, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4S)-2-[2-hydroxy-3-(hydroxymethyl)phenyl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 157184662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).