C26H22N4O6 — CID 157184900
ethyl 4-(4-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;ethyl 3-(4-cyanophenyl)-1H-pyrazole-5-carboxylate (PubChem CID 157184900) has the molecular formula C26H22N4O6 and a molecular weight of 486.48 g/mol. Its IUPAC name is ethyl 4-(4-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;ethyl 3-(4-cyanophenyl)-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 4-(4-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;ethyl 3-(4-cyanophenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 157184900 |
| Molecular Formula | C26H22N4O6 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | ethyl 4-(4-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;ethyl 3-(4-cyanophenyl)-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)C(=O)C=C(O)c1ccc(C#N)cc1.CCOC(=O)c1cc(-c2ccc(C#N)cc2)n[nH]1 |
| InChI | InChI=1S/C13H11N3O2.C13H11NO4/c1-2-18-13(17)12-7-11(15-16-12)10-5-3-9(8-14)4-6-10;1-2-18-13(17)12(16)7-11(15)10-5-3-9(8-14)4-6-10/h3-7H,2H2,1H3,(H,15,16);3-7,15H,2H2,1H3 |
| InChIKey | SMCUAGSBVKVGJR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 166.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|