About 1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride
1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride (PubChem CID 157184968) has the molecular formula C19H43Cl2N3
and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride.
Molecular Properties
| Compound Name | 1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride |
| PubChem CID | 157184968 |
| Molecular Formula | C19H43Cl2N3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | 1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride |
| SMILES | CC(C)CCN1CC[NH2+]CC1.CC(C)CC[NH+]1CCCCC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C10H21N.C9H20N2.2ClH/c1-10(2)6-9-11-7-4-3-5-8-11;1-9(2)3-6-11-7-4-10-5-8-11;;/h10H,3-9H2,1-2H3;9-10H,3-8H2,1-2H3;2*1H |
| InChIKey | BHPJZUBBNZRIKE-UHFFFAOYSA-N |
| XLogP | -4.98 |
| TPSA | 24.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | -4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride?
The IUPAC name of 1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride (CID 157184968) is 1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride.
What is the SMILES notation for 1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride?
The canonical SMILES for 1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride is CC(C)CCN1CC[NH2+]CC1.CC(C)CC[NH+]1CCCCC1.[Cl-].[Cl-].
What is the InChIKey of 1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride?
The InChIKey is BHPJZUBBNZRIKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N.C9H20N2.2ClH/c1-10(2)6-9-11-7-4-3-5-8-11;1-9(2)3-6-11-7-4-10-5-8-11;;/h10H,3-9H2,1-2H3;9-10H,3-8H2,1-2H3;2*1H.
What are the key properties of 1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride?
1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride has a molecular weight of 384.48 g/mol, XLogP of -4.98, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylbutyl)piperazin-4-ium;1-(3-methylbutyl)piperidin-1-ium;dichloride is sourced from PubChem (CID 157184968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).