C19H19BN2OS2 — CID 157185279
1-(dimethylboranylmethyl)-3-[(5-methyl-1-benzothiophen-3-yl)methyl]thieno[3,4-d]pyridazin-4-one (PubChem CID 157185279) has the molecular formula C19H19BN2OS2 and a molecular weight of 366.32 g/mol. Its IUPAC name is 1-(dimethylboranylmethyl)-3-[(5-methyl-1-benzothiophen-3-yl)methyl]thieno[3,4-d]pyridazin-4-one.
| Compound Name | 1-(dimethylboranylmethyl)-3-[(5-methyl-1-benzothiophen-3-yl)methyl]thieno[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 157185279 |
| Molecular Formula | C19H19BN2OS2 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 1-(dimethylboranylmethyl)-3-[(5-methyl-1-benzothiophen-3-yl)methyl]thieno[3,4-d]pyridazin-4-one |
| SMILES | CB(C)Cc1nn(Cc2csc3ccc(C)cc23)c(=O)c2cscc12 |
| InChI | InChI=1S/C19H19BN2OS2/c1-12-4-5-18-14(6-12)13(9-25-18)8-22-19(23)16-11-24-10-15(16)17(21-22)7-20(2)3/h4-6,9-11H,7-8H2,1-3H3 |
| InChIKey | PTAUSDSDJCBCTO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|