C11H15NO — CID 15718602
(7S)-7-(aminomethyl)-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 15718602) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (7S)-7-(aminomethyl)-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (7S)-7-(aminomethyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 15718602 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (7S)-7-(aminomethyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | NC[C@H]1CCc2ccc(O)cc2C1 |
| InChI | InChI=1S/C11H15NO/c12-7-8-1-2-9-3-4-11(13)6-10(9)5-8/h3-4,6,8,13H,1-2,5,7,12H2/t8-/m0/s1 |
| InChIKey | KOBHEEMVALUDQJ-QMMMGPOBSA-N |
| XLogP | 1.46 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |