C11H18F6O4S — CID 157186691
1-[3-(1-ethoxyethoxy)propylsulfonyl]-1,1,2,2,3,3-hexafluorobutane (PubChem CID 157186691) has the molecular formula C11H18F6O4S and a molecular weight of 360.32 g/mol. Its IUPAC name is 1-[3-(1-ethoxyethoxy)propylsulfonyl]-1,1,2,2,3,3-hexafluorobutane.
| Compound Name | 1-[3-(1-ethoxyethoxy)propylsulfonyl]-1,1,2,2,3,3-hexafluorobutane |
|---|---|
| PubChem CID | 157186691 |
| Molecular Formula | C11H18F6O4S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 1-[3-(1-ethoxyethoxy)propylsulfonyl]-1,1,2,2,3,3-hexafluorobutane |
| SMILES | CCOC(C)OCCCS(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C11H18F6O4S/c1-4-20-8(2)21-6-5-7-22(18,19)11(16,17)10(14,15)9(3,12)13/h8H,4-7H2,1-3H3 |
| InChIKey | YYCKQIULIFZTNG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|