C15H19F2N5O2S — CID 157186771
4-(6,7-dimethylquinazolin-4-yl)-6,6-difluoro-1,4-diazepane-1-sulfonamide (PubChem CID 157186771) has the molecular formula C15H19F2N5O2S and a molecular weight of 371.41 g/mol. Its IUPAC name is 4-(6,7-dimethylquinazolin-4-yl)-6,6-difluoro-1,4-diazepane-1-sulfonamide.
| Compound Name | 4-(6,7-dimethylquinazolin-4-yl)-6,6-difluoro-1,4-diazepane-1-sulfonamide |
|---|---|
| PubChem CID | 157186771 |
| Molecular Formula | C15H19F2N5O2S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-(6,7-dimethylquinazolin-4-yl)-6,6-difluoro-1,4-diazepane-1-sulfonamide |
| SMILES | Cc1cc2ncnc(N3CCN(S(N)(=O)=O)CC(F)(F)C3)c2cc1C |
| InChI | InChI=1S/C15H19F2N5O2S/c1-10-5-12-13(6-11(10)2)19-9-20-14(12)21-3-4-22(25(18,23)24)8-15(16,17)7-21/h5-6,9H,3-4,7-8H2,1-2H3,(H2,18,23,24) |
| InChIKey | BURMIENEADHGIU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |