C44H57N5O3 — CID 157188231
1,2,3,6,7,8,9-heptamethylquinolizin-4-one;1,3,6,7,8,9-hexamethylpyrido[1,2-a]pyrazin-4-one;2,3,4,7,8,9-hexamethylpyrido[1,2-a]pyrimidin-6-one (PubChem CID 157188231) has the molecular formula C44H57N5O3 and a molecular weight of 703.97 g/mol. Its IUPAC name is 1,2,3,6,7,8,9-heptamethylquinolizin-4-one;1,3,6,7,8,9-hexamethylpyrido[1,2-a]pyrazin-4-one;2,3,4,7,8,9-hexamethylpyrido[1,2-a]pyrimidin-6-one.
| Compound Name | 1,2,3,6,7,8,9-heptamethylquinolizin-4-one;1,3,6,7,8,9-hexamethylpyrido[1,2-a]pyrazin-4-one;2,3,4,7,8,9-hexamethylpyrido[1,2-a]pyrimidin-6-one |
|---|---|
| PubChem CID | 157188231 |
| Molecular Formula | C44H57N5O3 |
| Molecular Weight | 703.97 g/mol |
| Exact Mass | 703.45 |
| IUPAC Name | 1,2,3,6,7,8,9-heptamethylquinolizin-4-one;1,3,6,7,8,9-hexamethylpyrido[1,2-a]pyrazin-4-one;2,3,4,7,8,9-hexamethylpyrido[1,2-a]pyrimidin-6-one |
| SMILES | Cc1c(C)c(C)n2c(=O)c(C)c(C)c(C)c2c1C.Cc1c(C)c(C)n2c(=O)c(C)nc(C)c2c1C.Cc1nc2c(C)c(C)c(C)c(=O)n2c(C)c1C |
| InChI | InChI=1S/C16H21NO.2C14H18N2O/c1-8-10(3)14(7)17-15(11(8)4)12(5)9(2)13(6)16(17)18;1-7-8(2)12(6)16-13(9(7)3)10(4)15-11(5)14(16)17;1-7-8(2)13-15-11(5)10(4)12(6)16(13)14(17)9(7)3/h1-7H3;2*1-6H3 |
| InChIKey | APJMZHULTZNQBE-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 90.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.97 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |