About 1-methylpyrrolidin-2-one;nitromethane
1-methylpyrrolidin-2-one;nitromethane (PubChem CID 157188840) has the molecular formula C6H12N2O3
and a molecular weight of 160.17 g/mol. Its IUPAC name is 1-methylpyrrolidin-2-one;nitromethane.
Molecular Properties
| Compound Name | 1-methylpyrrolidin-2-one;nitromethane |
| PubChem CID | 157188840 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 1-methylpyrrolidin-2-one;nitromethane |
| SMILES | CN1CCCC1=O.C[N+](=O)[O-] |
| InChI | InChI=1S/C5H9NO.CH3NO2/c1-6-4-2-3-5(6)7;1-2(3)4/h2-4H2,1H3;1H3 |
| InChIKey | APLKEYHPKAKYNB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyrrolidin-2-one;nitromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidin-2-one;nitromethane?
The IUPAC name of 1-methylpyrrolidin-2-one;nitromethane (CID 157188840) is 1-methylpyrrolidin-2-one;nitromethane.
What is the SMILES notation for 1-methylpyrrolidin-2-one;nitromethane?
The canonical SMILES for 1-methylpyrrolidin-2-one;nitromethane is CN1CCCC1=O.C[N+](=O)[O-].
What is the InChIKey of 1-methylpyrrolidin-2-one;nitromethane?
The InChIKey is APLKEYHPKAKYNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.CH3NO2/c1-6-4-2-3-5(6)7;1-2(3)4/h2-4H2,1H3;1H3.
What are the key properties of 1-methylpyrrolidin-2-one;nitromethane?
1-methylpyrrolidin-2-one;nitromethane has a molecular weight of 160.17 g/mol, XLogP of 0.13, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidin-2-one;nitromethane is sourced from PubChem (CID 157188840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).