C26H24F6O6S2 — CID 157189636
2-benzoyloxy-3,3,3-trifluoropropane-1-sulfonate;1-[4-(2,2,2-trifluoroethoxy)naphthalen-1-yl]thiolan-1-ium (PubChem CID 157189636) has the molecular formula C26H24F6O6S2 and a molecular weight of 610.59 g/mol. Its IUPAC name is 2-benzoyloxy-3,3,3-trifluoropropane-1-sulfonate;1-[4-(2,2,2-trifluoroethoxy)naphthalen-1-yl]thiolan-1-ium.
| Compound Name | 2-benzoyloxy-3,3,3-trifluoropropane-1-sulfonate;1-[4-(2,2,2-trifluoroethoxy)naphthalen-1-yl]thiolan-1-ium |
|---|---|
| PubChem CID | 157189636 |
| Molecular Formula | C26H24F6O6S2 |
| Molecular Weight | 610.59 g/mol |
| Exact Mass | 610.09 |
| IUPAC Name | 2-benzoyloxy-3,3,3-trifluoropropane-1-sulfonate;1-[4-(2,2,2-trifluoroethoxy)naphthalen-1-yl]thiolan-1-ium |
| SMILES | FC(F)(F)COc1ccc([S+]2CCCC2)c2ccccc12.O=C(OC(CS(=O)(=O)[O-])C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H16F3OS.C10H9F3O5S/c17-16(18,19)11-20-14-7-8-15(21-9-3-4-10-21)13-6-2-1-5-12(13)14;11-10(12,13)8(6-19(15,16)17)18-9(14)7-4-2-1-3-5-7/h1-2,5-8H,3-4,9-11H2;1-5,8H,6H2,(H,15,16,17)/q+1;/p-1 |
| InChIKey | APNVJYIHGPUHLO-UHFFFAOYSA-M |
| XLogP | 5.87 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|