C16H20F4O4 — CID 157190183
(3R,4S,5S,7S)-7-fluoro-5-methoxy-4-[(2S,3R)-2-methyl-3-[(E)-4,4,4-trifluoro-3-methylbut-2-enyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-one (PubChem CID 157190183) has the molecular formula C16H20F4O4 and a molecular weight of 352.32 g/mol. Its IUPAC name is (3R,4S,5S,7S)-7-fluoro-5-methoxy-4-[(2S,3R)-2-methyl-3-[(E)-4,4,4-trifluoro-3-methylbut-2-enyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-one.
| Compound Name | (3R,4S,5S,7S)-7-fluoro-5-methoxy-4-[(2S,3R)-2-methyl-3-[(E)-4,4,4-trifluoro-3-methylbut-2-enyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-one |
|---|---|
| PubChem CID | 157190183 |
| Molecular Formula | C16H20F4O4 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (3R,4S,5S,7S)-7-fluoro-5-methoxy-4-[(2S,3R)-2-methyl-3-[(E)-4,4,4-trifluoro-3-methylbut-2-enyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-one |
| SMILES | CO[C@@H]1C(=O)[C@@H](F)C[C@]2(CO2)[C@H]1[C@]1(C)O[C@@H]1C/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C16H20F4O4/c1-8(16(18,19)20)4-5-10-14(2,24-10)13-12(22-3)11(21)9(17)6-15(13)7-23-15/h4,9-10,12-13H,5-7H2,1-3H3/b8-4+/t9-,10+,12+,13+,14+,15-/m0/s1 |
| InChIKey | PAWREIXFJBHEPL-WGJJRAISSA-N |
| XLogP | 2.75 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|