About 1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine)
1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine) (PubChem CID 157190991) has the molecular formula C24H51N3
and a molecular weight of 381.69 g/mol. Its IUPAC name is 1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine).
Molecular Properties
| Compound Name | 1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine) |
| PubChem CID | 157190991 |
| Molecular Formula | C24H51N3 |
| Molecular Weight | 381.69 g/mol |
| Exact Mass | 381.41 |
| IUPAC Name | 1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine) |
| SMILES | CC1CCCCN1C.CC1CCCCN1C.CCCCN1CCCCC1C |
| InChI | InChI=1S/C10H21N.2C7H15N/c1-3-4-8-11-9-6-5-7-10(11)2;2*1-7-5-3-4-6-8(7)2/h10H,3-9H2,1-2H3;2*7H,3-6H2,1-2H3 |
| InChIKey | APRQASQEFTZSDX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine)?
The IUPAC name of 1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine) (CID 157190991) is 1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine).
What is the SMILES notation for 1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine)?
The canonical SMILES for 1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine) is CC1CCCCN1C.CC1CCCCN1C.CCCCN1CCCCC1C.
What is the InChIKey of 1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine)?
The InChIKey is APRQASQEFTZSDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N.2C7H15N/c1-3-4-8-11-9-6-5-7-10(11)2;2*1-7-5-3-4-6-8(7)2/h10H,3-9H2,1-2H3;2*7H,3-6H2,1-2H3.
What are the key properties of 1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine)?
1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine) has a molecular weight of 381.69 g/mol, XLogP of 5.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-methylpiperidine;bis(1,2-dimethylpiperidine) is sourced from PubChem (CID 157190991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).