phosphoric acid;phosphorous acid;sulfuric acid

H8O11P2S — CID 157192236

IUPACphosphoric acid;phosphorous acid;sulfuric acid
SMILESO=P(O)(O)O.O=S(=O)(O)O.OP(O)O
InChIInChI=1S/H3O4P.H2O4S.H3O3P/c2*1-5(2,3)4;1-4(2)3/h(H3,1,2,3,4);(H2,1,2,3,4);1-3H
InChIKeyAPVICCJDHRWKNJ-UHFFFAOYSA-N
MW278.07 g/mol
LogP-2.39
Rot. Bonds

About phosphoric acid;phosphorous acid;sulfuric acid

phosphoric acid;phosphorous acid;sulfuric acid (PubChem CID 157192236) has the molecular formula H8O11P2S and a molecular weight of 278.07 g/mol. Its IUPAC name is phosphoric acid;phosphorous acid;sulfuric acid.

Molecular Properties

Compound Namephosphoric acid;phosphorous acid;sulfuric acid
PubChem CID157192236
Molecular FormulaH8O11P2S
Molecular Weight278.07 g/mol
Exact Mass277.93
IUPAC Namephosphoric acid;phosphorous acid;sulfuric acid
SMILESO=P(O)(O)O.O=S(=O)(O)O.OP(O)O
InChIInChI=1S/H3O4P.H2O4S.H3O3P/c2*1-5(2,3)4;1-4(2)3/h(H3,1,2,3,4);(H2,1,2,3,4);1-3H
InChIKeyAPVICCJDHRWKNJ-UHFFFAOYSA-N
XLogP-2.39
TPSA213.05 Ų
H-Bond Donors8
H-Bond Acceptors6
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500278.07
LogP ≤ 5-2.39
H-Bond Donors ≤ 58
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze phosphoric acid;phosphorous acid;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

azane;phosphoric acid;sulfuric acid
CID 173395945
phosphoric acid;sulfuric acid;trichlorophosphane
CID 174477268
alumane;phosphoric acid;sulfuric acid;zinc
CID 174818578
azane;phosphoric acid;phosphorous acid
CID 173381838
azane;phosphoric acid;phosphorous acid
CID 173231024
dicalcium;magnesium;hydride;phosphoric acid;sulfuric acid
CID 174825313
boric acid;phosphoric acid;sulfuric acid
CID 159985541
phosphoric acid;phosphorous acid;zinc;dihydrate
CID 173305022
potassium;sodium;azane;hydride;phosphoric acid;sulfuric acid
CID 173414415
tetralithium;phosphoric acid
CID 175822939
azane;phosphoric acid;sulfuric acid;urea
CID 173445990
tetralithium;hydride;phosphoric acid
CID 173293276

Frequently Asked Questions

What is the IUPAC name of phosphoric acid;phosphorous acid;sulfuric acid?
The IUPAC name of phosphoric acid;phosphorous acid;sulfuric acid (CID 157192236) is phosphoric acid;phosphorous acid;sulfuric acid.
What is the SMILES notation for phosphoric acid;phosphorous acid;sulfuric acid?
The canonical SMILES for phosphoric acid;phosphorous acid;sulfuric acid is O=P(O)(O)O.O=S(=O)(O)O.OP(O)O.
What is the InChIKey of phosphoric acid;phosphorous acid;sulfuric acid?
The InChIKey is APVICCJDHRWKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/H3O4P.H2O4S.H3O3P/c2*1-5(2,3)4;1-4(2)3/h(H3,1,2,3,4);(H2,1,2,3,4);1-3H.
What are the key properties of phosphoric acid;phosphorous acid;sulfuric acid?
phosphoric acid;phosphorous acid;sulfuric acid has a molecular weight of 278.07 g/mol, XLogP of -2.39, 0 rotatable bonds, 8 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phosphoric acid;phosphorous acid;sulfuric acid is sourced from PubChem (CID 157192236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).