About 3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one
3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one (PubChem CID 157192717) has the molecular formula C21H20Cl2N2O2
and a molecular weight of 403.31 g/mol. Its IUPAC name is 3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one.
Molecular Properties
| Compound Name | 3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one |
| PubChem CID | 157192717 |
| Molecular Formula | C21H20Cl2N2O2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one |
| SMILES | CC(C)(C)c1ccc(-c2cc(CCC(=O)c3cc(Cl)cnc3Cl)on2)cc1 |
| InChI | InChI=1S/C21H20Cl2N2O2/c1-21(2,3)14-6-4-13(5-7-14)18-11-16(27-25-18)8-9-19(26)17-10-15(22)12-24-20(17)23/h4-7,10-12H,8-9H2,1-3H3 |
| InChIKey | FATCIPOCEWZKIG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one?
The IUPAC name of 3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one (CID 157192717) is 3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one.
What is the SMILES notation for 3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one?
The canonical SMILES for 3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one is CC(C)(C)c1ccc(-c2cc(CCC(=O)c3cc(Cl)cnc3Cl)on2)cc1.
What is the InChIKey of 3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one?
The InChIKey is FATCIPOCEWZKIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20Cl2N2O2/c1-21(2,3)14-6-4-13(5-7-14)18-11-16(27-25-18)8-9-19(26)17-10-15(22)12-24-20(17)23/h4-7,10-12H,8-9H2,1-3H3.
What are the key properties of 3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one?
3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one has a molecular weight of 403.31 g/mol, XLogP of 6.16, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(4-tert-butylphenyl)-1,2-oxazol-5-yl]-1-(2,5-dichloro-3-pyridinyl)propan-1-one is sourced from PubChem (CID 157192717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).