C26H30O6 — CID 157192811
(2E,6E)-2-[(2,5-dimethoxy-4-methylphenyl)methylidene]-6-[[4-(hydroxymethyl)-2,5-dimethoxyphenyl]methylidene]cyclohexan-1-one (PubChem CID 157192811) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is (2E,6E)-2-[(2,5-dimethoxy-4-methylphenyl)methylidene]-6-[[4-(hydroxymethyl)-2,5-dimethoxyphenyl]methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2-[(2,5-dimethoxy-4-methylphenyl)methylidene]-6-[[4-(hydroxymethyl)-2,5-dimethoxyphenyl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 157192811 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (2E,6E)-2-[(2,5-dimethoxy-4-methylphenyl)methylidene]-6-[[4-(hydroxymethyl)-2,5-dimethoxyphenyl]methylidene]cyclohexan-1-one |
| SMILES | COc1cc(/C=C2\CCC/C(=C\c3cc(OC)c(CO)cc3OC)C2=O)c(OC)cc1C |
| InChI | InChI=1S/C26H30O6/c1-16-9-23(30-3)19(12-22(16)29-2)10-17-7-6-8-18(26(17)28)11-20-13-25(32-5)21(15-27)14-24(20)31-4/h9-14,27H,6-8,15H2,1-5H3/b17-10+,18-11+ |
| InChIKey | NIOPZLDIBSIYQU-ODPUSEOTSA-N |
| XLogP | 4.74 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|